C41H51F3O5 — CID 56613610
[(2R)-1,1,1-trifluorooctan-2-yl] 4-[3-[(2S)-2-methyloctoxy]-4-phenylbenzoyl]oxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate (PubChem CID 56613610) has the molecular formula C41H51F3O5 and a molecular weight of 680.85 g/mol. Its IUPAC name is [(2R)-1,1,1-trifluorooctan-2-yl] 4-[3-[(2S)-2-methyloctoxy]-4-phenylbenzoyl]oxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate.
| Compound Name | [(2R)-1,1,1-trifluorooctan-2-yl] 4-[3-[(2S)-2-methyloctoxy]-4-phenylbenzoyl]oxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 56613610 |
| Molecular Formula | C41H51F3O5 |
| Molecular Weight | 680.85 g/mol |
| Exact Mass | 680.37 |
| IUPAC Name | [(2R)-1,1,1-trifluorooctan-2-yl] 4-[3-[(2S)-2-methyloctoxy]-4-phenylbenzoyl]oxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate |
| SMILES | CCCCCC[C@H](C)COc1cc(C(=O)OC2CC(C(=O)O[C@H](CCCCCC)C(F)(F)F)Cc3ccccc32)ccc1-c1ccccc1 |
| InChI | InChI=1S/C41H51F3O5/c1-4-6-8-11-17-29(3)28-47-36-26-32(23-24-35(36)30-18-12-10-13-19-30)39(45)48-37-27-33(25-31-20-15-16-21-34(31)37)40(46)49-38(41(42,43)44)22-14-9-7-5-2/h10,12-13,15-16,18-21,23-24,26,29,33,37-38H,4-9,11,14,17,22,25,27-28H2,1-3H3/t29-,33?,37?,38+/m0/s1 |
| InChIKey | XZSCYQNIRKBVQB-UKCKBLELSA-N |
| XLogP | 11.24 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.85 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|