C27H30O3 — CID 56613968
(1S,8S,13S,14S)-13-methyl-1-[4-(3-oxoprop-2-enoxy)phenyl]-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 56613968) has the molecular formula C27H30O3 and a molecular weight of 402.53 g/mol. Its IUPAC name is (1S,8S,13S,14S)-13-methyl-1-[4-(3-oxoprop-2-enoxy)phenyl]-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (1S,8S,13S,14S)-13-methyl-1-[4-(3-oxoprop-2-enoxy)phenyl]-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 56613968 |
| Molecular Formula | C27H30O3 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | (1S,8S,13S,14S)-13-methyl-1-[4-(3-oxoprop-2-enoxy)phenyl]-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CCC3=CC(=O)C[C@@H](c4ccc(OCC=C=O)cc4)C3=C1CC2 |
| InChI | InChI=1S/C27H30O3/c1-27-12-2-4-25(27)22-10-7-19-16-20(29)17-24(26(19)23(22)11-13-27)18-5-8-21(9-6-18)30-15-3-14-28/h3,5-6,8-9,16,22,24-25H,2,4,7,10-13,15,17H2,1H3/t22-,24+,25+,27+/m1/s1 |
| InChIKey | QAWGUGZWPFOTSG-TXKDVJNZSA-N |
| XLogP | 5.74 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|