C24H24N2O2S — CID 56613969
(3R,4S)-4-(2-hydroxyethylsulfanyl)-3-(tritylamino)azetidin-2-one (PubChem CID 56613969) has the molecular formula C24H24N2O2S and a molecular weight of 404.54 g/mol. Its IUPAC name is (3R,4S)-4-(2-hydroxyethylsulfanyl)-3-(tritylamino)azetidin-2-one.
| Compound Name | (3R,4S)-4-(2-hydroxyethylsulfanyl)-3-(tritylamino)azetidin-2-one |
|---|---|
| PubChem CID | 56613969 |
| Molecular Formula | C24H24N2O2S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | (3R,4S)-4-(2-hydroxyethylsulfanyl)-3-(tritylamino)azetidin-2-one |
| SMILES | O=C1N[C@@H](SCCO)[C@@H]1NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H24N2O2S/c27-16-17-29-23-21(22(28)25-23)26-24(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15,21,23,26-27H,16-17H2,(H,25,28)/t21-,23+/m1/s1 |
| InChIKey | QBWGVVFRLIDQRF-GGAORHGYSA-N |
| XLogP | 3.12 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|