C27H23ClN4OS2 — CID 56614200
(4-chlorophenyl)methyl (3S)-3-[(benzylideneamino)carbamoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbodithioate (PubChem CID 56614200) has the molecular formula C27H23ClN4OS2 and a molecular weight of 519.10 g/mol. Its IUPAC name is (4-chlorophenyl)methyl (3S)-3-[(benzylideneamino)carbamoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbodithioate.
| Compound Name | (4-chlorophenyl)methyl (3S)-3-[(benzylideneamino)carbamoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbodithioate |
|---|---|
| PubChem CID | 56614200 |
| Molecular Formula | C27H23ClN4OS2 |
| Molecular Weight | 519.10 g/mol |
| Exact Mass | 518.10 |
| IUPAC Name | (4-chlorophenyl)methyl (3S)-3-[(benzylideneamino)carbamoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbodithioate |
| SMILES | O=C(NN=Cc1ccccc1)[C@@H]1Cc2c([nH]c3ccccc23)CN1C(=S)SCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H23ClN4OS2/c28-20-12-10-19(11-13-20)17-35-27(34)32-16-24-22(21-8-4-5-9-23(21)30-24)14-25(32)26(33)31-29-15-18-6-2-1-3-7-18/h1-13,15,25,30H,14,16-17H2,(H,31,33)/t25-/m0/s1 |
| InChIKey | GCQRZRZZVBIWAZ-VWLOTQADSA-N |
| XLogP | 5.92 |
| TPSA | 60.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.10 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|