About ethyl 3-oxo-3-[6-(3H-pyridin-4-ylidene)cyclohexa-1,3-dien-1-yl]propanoate
ethyl 3-oxo-3-[6-(3H-pyridin-4-ylidene)cyclohexa-1,3-dien-1-yl]propanoate (PubChem CID 56614252) has the molecular formula C16H17NO3
and a molecular weight of 271.32 g/mol. Its IUPAC name is ethyl 3-oxo-3-[6-(3H-pyridin-4-ylidene)cyclohexa-1,3-dien-1-yl]propanoate.
Molecular Properties
| Compound Name | ethyl 3-oxo-3-[6-(3H-pyridin-4-ylidene)cyclohexa-1,3-dien-1-yl]propanoate |
| PubChem CID | 56614252 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | ethyl 3-oxo-3-[6-(3H-pyridin-4-ylidene)cyclohexa-1,3-dien-1-yl]propanoate |
| SMILES | CCOC(=O)CC(=O)C1=CC=CCC1=C1C=CN=CC1 |
| InChI | InChI=1S/C16H17NO3/c1-2-20-16(19)11-15(18)14-6-4-3-5-13(14)12-7-9-17-10-8-12/h3-4,6-7,9-10H,2,5,8,11H2,1H3 |
| InChIKey | UKWLHNGILGWBDM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-oxo-3-[6-(3H-pyridin-4-ylidene)cyclohexa-1,3-dien-1-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-oxo-3-[6-(3H-pyridin-4-ylidene)cyclohexa-1,3-dien-1-yl]propanoate?
The IUPAC name of ethyl 3-oxo-3-[6-(3H-pyridin-4-ylidene)cyclohexa-1,3-dien-1-yl]propanoate (CID 56614252) is ethyl 3-oxo-3-[6-(3H-pyridin-4-ylidene)cyclohexa-1,3-dien-1-yl]propanoate.
What is the SMILES notation for ethyl 3-oxo-3-[6-(3H-pyridin-4-ylidene)cyclohexa-1,3-dien-1-yl]propanoate?
The canonical SMILES for ethyl 3-oxo-3-[6-(3H-pyridin-4-ylidene)cyclohexa-1,3-dien-1-yl]propanoate is CCOC(=O)CC(=O)C1=CC=CCC1=C1C=CN=CC1.
What is the InChIKey of ethyl 3-oxo-3-[6-(3H-pyridin-4-ylidene)cyclohexa-1,3-dien-1-yl]propanoate?
The InChIKey is UKWLHNGILGWBDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO3/c1-2-20-16(19)11-15(18)14-6-4-3-5-13(14)12-7-9-17-10-8-12/h3-4,6-7,9-10H,2,5,8,11H2,1H3.
What are the key properties of ethyl 3-oxo-3-[6-(3H-pyridin-4-ylidene)cyclohexa-1,3-dien-1-yl]propanoate?
ethyl 3-oxo-3-[6-(3H-pyridin-4-ylidene)cyclohexa-1,3-dien-1-yl]propanoate has a molecular weight of 271.32 g/mol, XLogP of 2.68, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-oxo-3-[6-(3H-pyridin-4-ylidene)cyclohexa-1,3-dien-1-yl]propanoate is sourced from PubChem (CID 56614252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).