C26H20N2O5 — CID 56615103
6-ethyl-2-[4-(4-ethylphenoxy)phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 56615103) has the molecular formula C26H20N2O5 and a molecular weight of 440.46 g/mol. Its IUPAC name is 6-ethyl-2-[4-(4-ethylphenoxy)phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 6-ethyl-2-[4-(4-ethylphenoxy)phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 56615103 |
| Molecular Formula | C26H20N2O5 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 6-ethyl-2-[4-(4-ethylphenoxy)phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | CCc1ccc(Oc2ccc(-n3c(=O)c4cc5c(=O)n(CC)c(=O)c5cc4c3=O)cc2)cc1 |
| InChI | InChI=1S/C26H20N2O5/c1-3-15-5-9-17(10-6-15)33-18-11-7-16(8-12-18)28-25(31)21-13-19-20(14-22(21)26(28)32)24(30)27(4-2)23(19)29/h5-14H,3-4H2,1-2H3 |
| InChIKey | QSDSZPSUTRYQOF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 87.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |