About [3-(oxan-2-yl)-1,2-oxazol-5-yl]methanol
[3-(oxan-2-yl)-1,2-oxazol-5-yl]methanol (PubChem CID 56615212) has the molecular formula C9H13NO3
and a molecular weight of 183.21 g/mol. Its IUPAC name is [3-(oxan-2-yl)-1,2-oxazol-5-yl]methanol.
Molecular Properties
| Compound Name | [3-(oxan-2-yl)-1,2-oxazol-5-yl]methanol |
| PubChem CID | 56615212 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | [3-(oxan-2-yl)-1,2-oxazol-5-yl]methanol |
| SMILES | OCc1cc(C2CCCCO2)no1 |
| InChI | InChI=1S/C9H13NO3/c11-6-7-5-8(10-13-7)9-3-1-2-4-12-9/h5,9,11H,1-4,6H2 |
| InChIKey | YMBKLYVFSBWSDF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(oxan-2-yl)-1,2-oxazol-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(oxan-2-yl)-1,2-oxazol-5-yl]methanol?
The IUPAC name of [3-(oxan-2-yl)-1,2-oxazol-5-yl]methanol (CID 56615212) is [3-(oxan-2-yl)-1,2-oxazol-5-yl]methanol.
What is the SMILES notation for [3-(oxan-2-yl)-1,2-oxazol-5-yl]methanol?
The canonical SMILES for [3-(oxan-2-yl)-1,2-oxazol-5-yl]methanol is OCc1cc(C2CCCCO2)no1.
What is the InChIKey of [3-(oxan-2-yl)-1,2-oxazol-5-yl]methanol?
The InChIKey is YMBKLYVFSBWSDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO3/c11-6-7-5-8(10-13-7)9-3-1-2-4-12-9/h5,9,11H,1-4,6H2.
What are the key properties of [3-(oxan-2-yl)-1,2-oxazol-5-yl]methanol?
[3-(oxan-2-yl)-1,2-oxazol-5-yl]methanol has a molecular weight of 183.21 g/mol, XLogP of 1.41, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(oxan-2-yl)-1,2-oxazol-5-yl]methanol is sourced from PubChem (CID 56615212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).