C18H19BrN2O4 — CID 56615428
2-[4-bromo-3-(3-nitrosobutan-2-yloxy)phenyl]-4,5,6,7-tetrahydroisoindole-1,3-dione (PubChem CID 56615428) has the molecular formula C18H19BrN2O4 and a molecular weight of 407.26 g/mol. Its IUPAC name is 2-[4-bromo-3-(3-nitrosobutan-2-yloxy)phenyl]-4,5,6,7-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-[4-bromo-3-(3-nitrosobutan-2-yloxy)phenyl]-4,5,6,7-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 56615428 |
| Molecular Formula | C18H19BrN2O4 |
| Molecular Weight | 407.26 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | 2-[4-bromo-3-(3-nitrosobutan-2-yloxy)phenyl]-4,5,6,7-tetrahydroisoindole-1,3-dione |
| SMILES | CC(N=O)C(C)Oc1cc(N2C(=O)C3=C(CCCC3)C2=O)ccc1Br |
| InChI | InChI=1S/C18H19BrN2O4/c1-10(20-24)11(2)25-16-9-12(7-8-15(16)19)21-17(22)13-5-3-4-6-14(13)18(21)23/h7-11H,3-6H2,1-2H3 |
| InChIKey | OFAYUWNAOMMAOQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.26 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|