C24H26O5 — CID 56615459
[(3aR,4R,5R,6aS)-4-(4-methyl-3-oxonon-1-en-6-ynyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate (PubChem CID 56615459) has the molecular formula C24H26O5 and a molecular weight of 394.47 g/mol. Its IUPAC name is [(3aR,4R,5R,6aS)-4-(4-methyl-3-oxonon-1-en-6-ynyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate.
| Compound Name | [(3aR,4R,5R,6aS)-4-(4-methyl-3-oxonon-1-en-6-ynyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate |
|---|---|
| PubChem CID | 56615459 |
| Molecular Formula | C24H26O5 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | [(3aR,4R,5R,6aS)-4-(4-methyl-3-oxonon-1-en-6-ynyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate |
| SMILES | CCC#CCC(C)C(=O)C=C[C@@H]1[C@H]2CC(=O)O[C@H]2C[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H26O5/c1-3-4-6-9-16(2)20(25)13-12-18-19-14-23(26)28-22(19)15-21(18)29-24(27)17-10-7-5-8-11-17/h5,7-8,10-13,16,18-19,21-22H,3,9,14-15H2,1-2H3/t16?,18-,19-,21-,22+/m1/s1 |
| InChIKey | FPXFEJJYRJAEFL-QQWUHFTESA-N |
| XLogP | 3.73 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|