About 3-methylsulfonyl-7-(trifluoromethyl)-1,2,4-benzotriazine
3-methylsulfonyl-7-(trifluoromethyl)-1,2,4-benzotriazine (PubChem CID 56616351) has the molecular formula C9H6F3N3O2S
and a molecular weight of 277.23 g/mol. Its IUPAC name is 3-methylsulfonyl-7-(trifluoromethyl)-1,2,4-benzotriazine.
Molecular Properties
| Compound Name | 3-methylsulfonyl-7-(trifluoromethyl)-1,2,4-benzotriazine |
| PubChem CID | 56616351 |
| Molecular Formula | C9H6F3N3O2S |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | 3-methylsulfonyl-7-(trifluoromethyl)-1,2,4-benzotriazine |
| SMILES | CS(=O)(=O)c1nnc2cc(C(F)(F)F)ccc2n1 |
| InChI | InChI=1S/C9H6F3N3O2S/c1-18(16,17)8-13-6-3-2-5(9(10,11)12)4-7(6)14-15-8/h2-4H,1H3 |
| InChIKey | HAVGMDYANNOGHY-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 72.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-methylsulfonyl-7-(trifluoromethyl)-1,2,4-benzotriazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylsulfonyl-7-(trifluoromethyl)-1,2,4-benzotriazine?
The IUPAC name of 3-methylsulfonyl-7-(trifluoromethyl)-1,2,4-benzotriazine (CID 56616351) is 3-methylsulfonyl-7-(trifluoromethyl)-1,2,4-benzotriazine.
What is the SMILES notation for 3-methylsulfonyl-7-(trifluoromethyl)-1,2,4-benzotriazine?
The canonical SMILES for 3-methylsulfonyl-7-(trifluoromethyl)-1,2,4-benzotriazine is CS(=O)(=O)c1nnc2cc(C(F)(F)F)ccc2n1.
What is the InChIKey of 3-methylsulfonyl-7-(trifluoromethyl)-1,2,4-benzotriazine?
The InChIKey is HAVGMDYANNOGHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F3N3O2S/c1-18(16,17)8-13-6-3-2-5(9(10,11)12)4-7(6)14-15-8/h2-4H,1H3.
What are the key properties of 3-methylsulfonyl-7-(trifluoromethyl)-1,2,4-benzotriazine?
3-methylsulfonyl-7-(trifluoromethyl)-1,2,4-benzotriazine has a molecular weight of 277.23 g/mol, XLogP of 1.45, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylsulfonyl-7-(trifluoromethyl)-1,2,4-benzotriazine is sourced from PubChem (CID 56616351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).