C16H31NO3Si — CID 56616376
3-[(2R,3S)-1-[tert-butyl(dimethyl)silyl]-3-(2-hydroxyethyl)-4-oxoazetidin-2-yl]-2,2-dimethylpropanal (PubChem CID 56616376) has the molecular formula C16H31NO3Si and a molecular weight of 313.51 g/mol. Its IUPAC name is 3-[(2R,3S)-1-[tert-butyl(dimethyl)silyl]-3-(2-hydroxyethyl)-4-oxoazetidin-2-yl]-2,2-dimethylpropanal.
| Compound Name | 3-[(2R,3S)-1-[tert-butyl(dimethyl)silyl]-3-(2-hydroxyethyl)-4-oxoazetidin-2-yl]-2,2-dimethylpropanal |
|---|---|
| PubChem CID | 56616376 |
| Molecular Formula | C16H31NO3Si |
| Molecular Weight | 313.51 g/mol |
| Exact Mass | 313.21 |
| IUPAC Name | 3-[(2R,3S)-1-[tert-butyl(dimethyl)silyl]-3-(2-hydroxyethyl)-4-oxoazetidin-2-yl]-2,2-dimethylpropanal |
| SMILES | CC(C)(C=O)C[C@@H]1[C@H](CCO)C(=O)N1[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H31NO3Si/c1-15(2,3)21(6,7)17-13(10-16(4,5)11-19)12(8-9-18)14(17)20/h11-13,18H,8-10H2,1-7H3/t12-,13+/m0/s1 |
| InChIKey | OLGHLYVSSIDKKS-QWHCGFSZSA-N |
| XLogP | 2.82 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.51 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|