C23H19NO2S — CID 56616690
3-[(2-hydroxyphenyl)iminomethyl]-6-methyl-2-phenyl-2,3-dihydrothiochromen-4-one (PubChem CID 56616690) has the molecular formula C23H19NO2S and a molecular weight of 373.48 g/mol. Its IUPAC name is 3-[(2-hydroxyphenyl)iminomethyl]-6-methyl-2-phenyl-2,3-dihydrothiochromen-4-one.
| Compound Name | 3-[(2-hydroxyphenyl)iminomethyl]-6-methyl-2-phenyl-2,3-dihydrothiochromen-4-one |
|---|---|
| PubChem CID | 56616690 |
| Molecular Formula | C23H19NO2S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 3-[(2-hydroxyphenyl)iminomethyl]-6-methyl-2-phenyl-2,3-dihydrothiochromen-4-one |
| SMILES | Cc1ccc2c(c1)C(=O)C(/C=N/c1ccccc1O)C(c1ccccc1)S2 |
| InChI | InChI=1S/C23H19NO2S/c1-15-11-12-21-17(13-15)22(26)18(14-24-19-9-5-6-10-20(19)25)23(27-21)16-7-3-2-4-8-16/h2-14,18,23,25H,1H3/b24-14+ |
| InChIKey | UJWLDBSTZJMUGZ-ZVHZXABRSA-N |
| XLogP | 5.75 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|