C7H8N2O — CID 56616793
1,2,4,7-tetrahydroindazol-3-one (PubChem CID 56616793) has the molecular formula C7H8N2O and a molecular weight of 136.15 g/mol. Its IUPAC name is 1,2,4,7-tetrahydroindazol-3-one.
| Compound Name | 1,2,4,7-tetrahydroindazol-3-one |
|---|---|
| PubChem CID | 56616793 |
| Molecular Formula | C7H8N2O |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.06 |
| IUPAC Name | 1,2,4,7-tetrahydroindazol-3-one |
| SMILES | O=c1[nH][nH]c2c1CC=CC2 |
| InChI | InChI=1S/C7H8N2O/c10-7-5-3-1-2-4-6(5)8-9-7/h1-2H,3-4H2,(H2,8,9,10) |
| InChIKey | XDXOXBYIUYPCMK-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|