About hex-2-enyl hex-2-enoate
hex-2-enyl hex-2-enoate (PubChem CID 566171) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is hex-2-enyl hex-2-enoate.
Molecular Properties
| Compound Name | hex-2-enyl hex-2-enoate |
| PubChem CID | 566171 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | hex-2-enyl hex-2-enoate |
| SMILES | CCCC=CCOC(=O)C=CCCC |
| InChI | InChI=1S/C12H20O2/c1-3-5-7-9-11-14-12(13)10-8-6-4-2/h7-10H,3-6,11H2,1-2H3 |
| InChIKey | QZZVRWSUQQJJOS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze hex-2-enyl hex-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hex-2-enyl hex-2-enoate?
The IUPAC name of hex-2-enyl hex-2-enoate (CID 566171) is hex-2-enyl hex-2-enoate.
What is the SMILES notation for hex-2-enyl hex-2-enoate?
The canonical SMILES for hex-2-enyl hex-2-enoate is CCCC=CCOC(=O)C=CCCC.
What is the InChIKey of hex-2-enyl hex-2-enoate?
The InChIKey is QZZVRWSUQQJJOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O2/c1-3-5-7-9-11-14-12(13)10-8-6-4-2/h7-10H,3-6,11H2,1-2H3.
What are the key properties of hex-2-enyl hex-2-enoate?
hex-2-enyl hex-2-enoate has a molecular weight of 196.29 g/mol, XLogP of 3.24, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hex-2-enyl hex-2-enoate is sourced from PubChem (CID 566171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).