C10H13BrNO6P — CID 56617340
[(4-bromophenoxy)-hydroxyphosphoryl] (2S)-2-(methoxyamino)propanoate (PubChem CID 56617340) has the molecular formula C10H13BrNO6P and a molecular weight of 354.09 g/mol. Its IUPAC name is [(4-bromophenoxy)-hydroxyphosphoryl] (2S)-2-(methoxyamino)propanoate.
| Compound Name | [(4-bromophenoxy)-hydroxyphosphoryl] (2S)-2-(methoxyamino)propanoate |
|---|---|
| PubChem CID | 56617340 |
| Molecular Formula | C10H13BrNO6P |
| Molecular Weight | 354.09 g/mol |
| Exact Mass | 352.97 |
| IUPAC Name | [(4-bromophenoxy)-hydroxyphosphoryl] (2S)-2-(methoxyamino)propanoate |
| SMILES | CON[C@@H](C)C(=O)OP(=O)(O)Oc1ccc(Br)cc1 |
| InChI | InChI=1S/C10H13BrNO6P/c1-7(12-16-2)10(13)18-19(14,15)17-9-5-3-8(11)4-6-9/h3-7,12H,1-2H3,(H,14,15)/t7-/m0/s1 |
| InChIKey | GEZKXFWLUHPVNP-ZETCQYMHSA-N |
| XLogP | 2.01 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.09 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|