C28H42O — CID 56617676
1-tert-butyl-4-[1-[2-(4-tert-butylphenyl)-2-methylpropoxy]-2-methylpropan-2-yl]benzene (PubChem CID 56617676) has the molecular formula C28H42O and a molecular weight of 394.64 g/mol. Its IUPAC name is 1-tert-butyl-4-[1-[2-(4-tert-butylphenyl)-2-methylpropoxy]-2-methylpropan-2-yl]benzene.
| Compound Name | 1-tert-butyl-4-[1-[2-(4-tert-butylphenyl)-2-methylpropoxy]-2-methylpropan-2-yl]benzene |
|---|---|
| PubChem CID | 56617676 |
| Molecular Formula | C28H42O |
| Molecular Weight | 394.64 g/mol |
| Exact Mass | 394.32 |
| IUPAC Name | 1-tert-butyl-4-[1-[2-(4-tert-butylphenyl)-2-methylpropoxy]-2-methylpropan-2-yl]benzene |
| SMILES | CC(C)(C)c1ccc(C(C)(C)COCC(C)(C)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C28H42O/c1-25(2,3)21-11-15-23(16-12-21)27(7,8)19-29-20-28(9,10)24-17-13-22(14-18-24)26(4,5)6/h11-18H,19-20H2,1-10H3 |
| InChIKey | MOHFGDYKQCCZPQ-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.64 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |