C6H4Br6O — CID 56617780
2,3,3-tribromo-3-(1,1,2-tribromoprop-2-enoxy)prop-1-ene (PubChem CID 56617780) has the molecular formula C6H4Br6O and a molecular weight of 571.52 g/mol. Its IUPAC name is 2,3,3-tribromo-3-(1,1,2-tribromoprop-2-enoxy)prop-1-ene.
| Compound Name | 2,3,3-tribromo-3-(1,1,2-tribromoprop-2-enoxy)prop-1-ene |
|---|---|
| PubChem CID | 56617780 |
| Molecular Formula | C6H4Br6O |
| Molecular Weight | 571.52 g/mol |
| Exact Mass | 565.54 |
| IUPAC Name | 2,3,3-tribromo-3-(1,1,2-tribromoprop-2-enoxy)prop-1-ene |
| SMILES | C=C(Br)C(Br)(Br)OC(Br)(Br)C(=C)Br |
| InChI | InChI=1S/C6H4Br6O/c1-3(7)5(9,10)13-6(11,12)4(2)8/h1-2H2 |
| InChIKey | UURICGIEYPUPRP-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.52 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|