C26H36O9Si — CID 56618541
1-[(2S,3S,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-3,4-diphenoxy-2-triethylsilyloxyoxan-2-yl]ethanone (PubChem CID 56618541) has the molecular formula C26H36O9Si and a molecular weight of 520.65 g/mol. Its IUPAC name is 1-[(2S,3S,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-3,4-diphenoxy-2-triethylsilyloxyoxan-2-yl]ethanone.
| Compound Name | 1-[(2S,3S,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-3,4-diphenoxy-2-triethylsilyloxyoxan-2-yl]ethanone |
|---|---|
| PubChem CID | 56618541 |
| Molecular Formula | C26H36O9Si |
| Molecular Weight | 520.65 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | 1-[(2S,3S,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-3,4-diphenoxy-2-triethylsilyloxyoxan-2-yl]ethanone |
| SMILES | CC[Si](CC)(CC)O[C@]1(C(C)=O)O[C@H](CO)[C@@H](O)[C@@](O)(Oc2ccccc2)[C@]1(O)Oc1ccccc1 |
| InChI | InChI=1S/C26H36O9Si/c1-5-36(6-2,7-3)35-25(19(4)28)26(31,33-21-16-12-9-13-17-21)24(30,23(29)22(18-27)34-25)32-20-14-10-8-11-15-20/h8-17,22-23,27,29-31H,5-7,18H2,1-4H3/t22-,23-,24-,25+,26+/m1/s1 |
| InChIKey | XKFHFZKCFGZZTR-OYHZZYGJSA-N |
| XLogP | 2.58 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.65 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|