C17H25FO7S — CID 56618776
[(1R,2R,3S,4S)-2-fluoro-3-(methoxymethoxy)-4-(methoxymethoxymethyl)cyclopentyl] 4-methylbenzenesulfonate (PubChem CID 56618776) has the molecular formula C17H25FO7S and a molecular weight of 392.45 g/mol. Its IUPAC name is [(1R,2R,3S,4S)-2-fluoro-3-(methoxymethoxy)-4-(methoxymethoxymethyl)cyclopentyl] 4-methylbenzenesulfonate.
| Compound Name | [(1R,2R,3S,4S)-2-fluoro-3-(methoxymethoxy)-4-(methoxymethoxymethyl)cyclopentyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 56618776 |
| Molecular Formula | C17H25FO7S |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | [(1R,2R,3S,4S)-2-fluoro-3-(methoxymethoxy)-4-(methoxymethoxymethyl)cyclopentyl] 4-methylbenzenesulfonate |
| SMILES | COCOC[C@@H]1C[C@@H](OS(=O)(=O)c2ccc(C)cc2)[C@H](F)[C@H]1OCOC |
| InChI | InChI=1S/C17H25FO7S/c1-12-4-6-14(7-5-12)26(19,20)25-15-8-13(9-23-10-21-2)17(16(15)18)24-11-22-3/h4-7,13,15-17H,8-11H2,1-3H3/t13-,15+,16-,17-/m0/s1 |
| InChIKey | LEUSTTZWVDTAII-ORQFMDKSSA-N |
| XLogP | 2.04 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|