About 3-[3-(dimethylamino)propylsulfonyl]-N,N-dimethylpropan-1-amine
3-[3-(dimethylamino)propylsulfonyl]-N,N-dimethylpropan-1-amine (PubChem CID 56618829) has the molecular formula C10H24N2O2S
and a molecular weight of 236.38 g/mol. Its IUPAC name is 3-[3-(dimethylamino)propylsulfonyl]-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-[3-(dimethylamino)propylsulfonyl]-N,N-dimethylpropan-1-amine |
| PubChem CID | 56618829 |
| Molecular Formula | C10H24N2O2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 3-[3-(dimethylamino)propylsulfonyl]-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCS(=O)(=O)CCCN(C)C |
| InChI | InChI=1S/C10H24N2O2S/c1-11(2)7-5-9-15(13,14)10-6-8-12(3)4/h5-10H2,1-4H3 |
| InChIKey | ZCFYUFDEMVQEOK-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[3-(dimethylamino)propylsulfonyl]-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(dimethylamino)propylsulfonyl]-N,N-dimethylpropan-1-amine?
The IUPAC name of 3-[3-(dimethylamino)propylsulfonyl]-N,N-dimethylpropan-1-amine (CID 56618829) is 3-[3-(dimethylamino)propylsulfonyl]-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 3-[3-(dimethylamino)propylsulfonyl]-N,N-dimethylpropan-1-amine?
The canonical SMILES for 3-[3-(dimethylamino)propylsulfonyl]-N,N-dimethylpropan-1-amine is CN(C)CCCS(=O)(=O)CCCN(C)C.
What is the InChIKey of 3-[3-(dimethylamino)propylsulfonyl]-N,N-dimethylpropan-1-amine?
The InChIKey is ZCFYUFDEMVQEOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24N2O2S/c1-11(2)7-5-9-15(13,14)10-6-8-12(3)4/h5-10H2,1-4H3.
What are the key properties of 3-[3-(dimethylamino)propylsulfonyl]-N,N-dimethylpropan-1-amine?
3-[3-(dimethylamino)propylsulfonyl]-N,N-dimethylpropan-1-amine has a molecular weight of 236.38 g/mol, XLogP of 0.30, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(dimethylamino)propylsulfonyl]-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 56618829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).