About 6-(2,3,4-trimethylphenoxy)pyrimido[6,1-a]isoquinolin-4-one
6-(2,3,4-trimethylphenoxy)pyrimido[6,1-a]isoquinolin-4-one (PubChem CID 56619554) has the molecular formula C21H18N2O2
and a molecular weight of 330.39 g/mol. Its IUPAC name is 6-(2,3,4-trimethylphenoxy)pyrimido[6,1-a]isoquinolin-4-one.
Molecular Properties
| Compound Name | 6-(2,3,4-trimethylphenoxy)pyrimido[6,1-a]isoquinolin-4-one |
| PubChem CID | 56619554 |
| Molecular Formula | C21H18N2O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 6-(2,3,4-trimethylphenoxy)pyrimido[6,1-a]isoquinolin-4-one |
| SMILES | Cc1ccc(Oc2cc3ccccc3c3ccnc(=O)n23)c(C)c1C |
| InChI | InChI=1S/C21H18N2O2/c1-13-8-9-19(15(3)14(13)2)25-20-12-16-6-4-5-7-17(16)18-10-11-22-21(24)23(18)20/h4-12H,1-3H3 |
| InChIKey | XCZLYWZPFVDQIQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 6-(2,3,4-trimethylphenoxy)pyrimido[6,1-a]isoquinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,3,4-trimethylphenoxy)pyrimido[6,1-a]isoquinolin-4-one?
The IUPAC name of 6-(2,3,4-trimethylphenoxy)pyrimido[6,1-a]isoquinolin-4-one (CID 56619554) is 6-(2,3,4-trimethylphenoxy)pyrimido[6,1-a]isoquinolin-4-one.
What is the SMILES notation for 6-(2,3,4-trimethylphenoxy)pyrimido[6,1-a]isoquinolin-4-one?
The canonical SMILES for 6-(2,3,4-trimethylphenoxy)pyrimido[6,1-a]isoquinolin-4-one is Cc1ccc(Oc2cc3ccccc3c3ccnc(=O)n23)c(C)c1C.
What is the InChIKey of 6-(2,3,4-trimethylphenoxy)pyrimido[6,1-a]isoquinolin-4-one?
The InChIKey is XCZLYWZPFVDQIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N2O2/c1-13-8-9-19(15(3)14(13)2)25-20-12-16-6-4-5-7-17(16)18-10-11-22-21(24)23(18)20/h4-12H,1-3H3.
What are the key properties of 6-(2,3,4-trimethylphenoxy)pyrimido[6,1-a]isoquinolin-4-one?
6-(2,3,4-trimethylphenoxy)pyrimido[6,1-a]isoquinolin-4-one has a molecular weight of 330.39 g/mol, XLogP of 4.57, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,3,4-trimethylphenoxy)pyrimido[6,1-a]isoquinolin-4-one is sourced from PubChem (CID 56619554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).