C16H23F3O4 — CID 56619762
5-butoxy-2-[4-(2,2,2-trifluoroethoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane (PubChem CID 56619762) has the molecular formula C16H23F3O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is 5-butoxy-2-[4-(2,2,2-trifluoroethoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane.
| Compound Name | 5-butoxy-2-[4-(2,2,2-trifluoroethoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 56619762 |
| Molecular Formula | C16H23F3O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 5-butoxy-2-[4-(2,2,2-trifluoroethoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane |
| SMILES | CCCCOC1COC(C2=CCC(OCC(F)(F)F)C=C2)OC1 |
| InChI | InChI=1S/C16H23F3O4/c1-2-3-8-20-14-9-21-15(22-10-14)12-4-6-13(7-5-12)23-11-16(17,18)19/h4-6,13-15H,2-3,7-11H2,1H3 |
| InChIKey | ZBNKKSTYDUFCTI-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|