3-methanimidoyl-2,2-dimethylcyclopropane-1-carboxylic acid

C7H11NO2 — CID 56619789

IUPAC3-methanimidoyl-2,2-dimethylcyclopropane-1-carboxylic acid
SMILES[H]/N=C/C1C(C(=O)O)C1(C)C
InChIInChI=1S/C7H11NO2/c1-7(2)4(3-8)5(7)6(9)10/h3-5,8H,1-2H3,(H,9,10)/b8-3+
InChIKeyXCZLKDLQZVCRGO-FPYGCLRLSA-N
MW141.17 g/mol
LogP0.99
Rot. Bonds2

About 3-methanimidoyl-2,2-dimethylcyclopropane-1-carboxylic acid

3-methanimidoyl-2,2-dimethylcyclopropane-1-carboxylic acid (PubChem CID 56619789) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is 3-methanimidoyl-2,2-dimethylcyclopropane-1-carboxylic acid.

Molecular Properties

Compound Name3-methanimidoyl-2,2-dimethylcyclopropane-1-carboxylic acid
PubChem CID56619789
Molecular FormulaC7H11NO2
Molecular Weight141.17 g/mol
Exact Mass141.08
IUPAC Name3-methanimidoyl-2,2-dimethylcyclopropane-1-carboxylic acid
SMILES[H]/N=C/C1C(C(=O)O)C1(C)C
InChIInChI=1S/C7H11NO2/c1-7(2)4(3-8)5(7)6(9)10/h3-5,8H,1-2H3,(H,9,10)/b8-3+
InChIKeyXCZLKDLQZVCRGO-FPYGCLRLSA-N
XLogP0.99
TPSA61.15 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500141.17
LogP ≤ 50.99
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}

Analyze 3-methanimidoyl-2,2-dimethylcyclopropane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methanimidoyl-2,2-dimethylcyclopropane-1-carboxylic acid?
The IUPAC name of 3-methanimidoyl-2,2-dimethylcyclopropane-1-carboxylic acid (CID 56619789) is 3-methanimidoyl-2,2-dimethylcyclopropane-1-carboxylic acid.
What is the SMILES notation for 3-methanimidoyl-2,2-dimethylcyclopropane-1-carboxylic acid?
The canonical SMILES for 3-methanimidoyl-2,2-dimethylcyclopropane-1-carboxylic acid is [H]/N=C/C1C(C(=O)O)C1(C)C.
What is the InChIKey of 3-methanimidoyl-2,2-dimethylcyclopropane-1-carboxylic acid?
The InChIKey is XCZLKDLQZVCRGO-FPYGCLRLSA-N. The full InChI is InChI=1S/C7H11NO2/c1-7(2)4(3-8)5(7)6(9)10/h3-5,8H,1-2H3,(H,9,10)/b8-3+.
What are the key properties of 3-methanimidoyl-2,2-dimethylcyclopropane-1-carboxylic acid?
3-methanimidoyl-2,2-dimethylcyclopropane-1-carboxylic acid has a molecular weight of 141.17 g/mol, XLogP of 0.99, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methanimidoyl-2,2-dimethylcyclopropane-1-carboxylic acid is sourced from PubChem (CID 56619789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).