C17H29NO — CID 56619995
2-methyl-N-[3-[(2-methylpropan-2-yl)oxy]propyl]-3-phenylpropan-1-amine (PubChem CID 56619995) has the molecular formula C17H29NO and a molecular weight of 263.43 g/mol. Its IUPAC name is 2-methyl-N-[3-[(2-methylpropan-2-yl)oxy]propyl]-3-phenylpropan-1-amine.
| Compound Name | 2-methyl-N-[3-[(2-methylpropan-2-yl)oxy]propyl]-3-phenylpropan-1-amine |
|---|---|
| PubChem CID | 56619995 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 2-methyl-N-[3-[(2-methylpropan-2-yl)oxy]propyl]-3-phenylpropan-1-amine |
| SMILES | CC(CNCCCOC(C)(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C17H29NO/c1-15(13-16-9-6-5-7-10-16)14-18-11-8-12-19-17(2,3)4/h5-7,9-10,15,18H,8,11-14H2,1-4H3 |
| InChIKey | HBAURCMZOTYTKH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|