C26H46N2O2 — CID 56619996
2,5-bis[6-(ethylamino)-2-methylheptan-2-yl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 56619996) has the molecular formula C26H46N2O2 and a molecular weight of 418.67 g/mol. Its IUPAC name is 2,5-bis[6-(ethylamino)-2-methylheptan-2-yl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-bis[6-(ethylamino)-2-methylheptan-2-yl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 56619996 |
| Molecular Formula | C26H46N2O2 |
| Molecular Weight | 418.67 g/mol |
| Exact Mass | 418.36 |
| IUPAC Name | 2,5-bis[6-(ethylamino)-2-methylheptan-2-yl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CCNC(C)CCCC(C)(C)C1=CC(=O)C(C(C)(C)CCCC(C)NCC)=CC1=O |
| InChI | InChI=1S/C26H46N2O2/c1-9-27-19(3)13-11-15-25(5,6)21-17-24(30)22(18-23(21)29)26(7,8)16-12-14-20(4)28-10-2/h17-20,27-28H,9-16H2,1-8H3 |
| InChIKey | SANLYTQXXCANCP-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.67 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|