C17H25F3O3 — CID 56620076
5-pentyl-2-[4-(2,2,2-trifluoroethoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane (PubChem CID 56620076) has the molecular formula C17H25F3O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is 5-pentyl-2-[4-(2,2,2-trifluoroethoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane.
| Compound Name | 5-pentyl-2-[4-(2,2,2-trifluoroethoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 56620076 |
| Molecular Formula | C17H25F3O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 5-pentyl-2-[4-(2,2,2-trifluoroethoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane |
| SMILES | CCCCCC1COC(C2=CCC(OCC(F)(F)F)C=C2)OC1 |
| InChI | InChI=1S/C17H25F3O3/c1-2-3-4-5-13-10-21-16(22-11-13)14-6-8-15(9-7-14)23-12-17(18,19)20/h6-8,13,15-16H,2-5,9-12H2,1H3 |
| InChIKey | VMPGUMDOONMYSV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|