About N-[butyl(dimethyl)silyl]-2,2,2-trifluoroacetamide
N-[butyl(dimethyl)silyl]-2,2,2-trifluoroacetamide (PubChem CID 56620199) has the molecular formula C8H16F3NOSi
and a molecular weight of 227.30 g/mol. Its IUPAC name is N-[butyl(dimethyl)silyl]-2,2,2-trifluoroacetamide.
Molecular Properties
| Compound Name | N-[butyl(dimethyl)silyl]-2,2,2-trifluoroacetamide |
| PubChem CID | 56620199 |
| Molecular Formula | C8H16F3NOSi |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | N-[butyl(dimethyl)silyl]-2,2,2-trifluoroacetamide |
| SMILES | CCCC[Si](C)(C)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C8H16F3NOSi/c1-4-5-6-14(2,3)12-7(13)8(9,10)11/h4-6H2,1-3H3,(H,12,13) |
| InChIKey | FXASDGZDIQTZDA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-[butyl(dimethyl)silyl]-2,2,2-trifluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[butyl(dimethyl)silyl]-2,2,2-trifluoroacetamide?
The IUPAC name of N-[butyl(dimethyl)silyl]-2,2,2-trifluoroacetamide (CID 56620199) is N-[butyl(dimethyl)silyl]-2,2,2-trifluoroacetamide.
What is the SMILES notation for N-[butyl(dimethyl)silyl]-2,2,2-trifluoroacetamide?
The canonical SMILES for N-[butyl(dimethyl)silyl]-2,2,2-trifluoroacetamide is CCCC[Si](C)(C)NC(=O)C(F)(F)F.
What is the InChIKey of N-[butyl(dimethyl)silyl]-2,2,2-trifluoroacetamide?
The InChIKey is FXASDGZDIQTZDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16F3NOSi/c1-4-5-6-14(2,3)12-7(13)8(9,10)11/h4-6H2,1-3H3,(H,12,13).
What are the key properties of N-[butyl(dimethyl)silyl]-2,2,2-trifluoroacetamide?
N-[butyl(dimethyl)silyl]-2,2,2-trifluoroacetamide has a molecular weight of 227.30 g/mol, XLogP of 2.67, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[butyl(dimethyl)silyl]-2,2,2-trifluoroacetamide is sourced from PubChem (CID 56620199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).