C30H46O2S — CID 56620362
1,3,3-trimethyl-2-[3-methyl-5-[3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienyl]sulfonylpenta-1,3-dienyl]cyclohexene (PubChem CID 56620362) has the molecular formula C30H46O2S and a molecular weight of 470.76 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-[3-methyl-5-[3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienyl]sulfonylpenta-1,3-dienyl]cyclohexene.
| Compound Name | 1,3,3-trimethyl-2-[3-methyl-5-[3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienyl]sulfonylpenta-1,3-dienyl]cyclohexene |
|---|---|
| PubChem CID | 56620362 |
| Molecular Formula | C30H46O2S |
| Molecular Weight | 470.76 g/mol |
| Exact Mass | 470.32 |
| IUPAC Name | 1,3,3-trimethyl-2-[3-methyl-5-[3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienyl]sulfonylpenta-1,3-dienyl]cyclohexene |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=CCS(=O)(=O)CC=C(C)C=CC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C30H46O2S/c1-23(13-15-27-25(3)11-9-19-29(27,5)6)17-21-33(31,32)22-18-24(2)14-16-28-26(4)12-10-20-30(28,7)8/h13-18H,9-12,19-22H2,1-8H3 |
| InChIKey | ZKCPHPORMXKVGG-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.76 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|