C8H9NO2 — CID 56620432
3-(but-2-enylamino)cyclobut-3-ene-1,2-dione (PubChem CID 56620432) has the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. Its IUPAC name is 3-(but-2-enylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(but-2-enylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 56620432 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 3-(but-2-enylamino)cyclobut-3-ene-1,2-dione |
| SMILES | CC=CCNc1cc(=O)c1=O |
| InChI | InChI=1S/C8H9NO2/c1-2-3-4-9-6-5-7(10)8(6)11/h2-3,5,9H,4H2,1H3 |
| InChIKey | DIHFJLWGOQNLML-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|