C13H13F4N5O8S2 — CID 56620829
[2-(1,1,2,2-tetrafluoroethoxy)phenyl] N-[(4,6-dimethoxy-1,3,5-triazin-2-yl)sulfamoyl]sulfamate (PubChem CID 56620829) has the molecular formula C13H13F4N5O8S2 and a molecular weight of 507.40 g/mol. Its IUPAC name is [2-(1,1,2,2-tetrafluoroethoxy)phenyl] N-[(4,6-dimethoxy-1,3,5-triazin-2-yl)sulfamoyl]sulfamate.
| Compound Name | [2-(1,1,2,2-tetrafluoroethoxy)phenyl] N-[(4,6-dimethoxy-1,3,5-triazin-2-yl)sulfamoyl]sulfamate |
|---|---|
| PubChem CID | 56620829 |
| Molecular Formula | C13H13F4N5O8S2 |
| Molecular Weight | 507.40 g/mol |
| Exact Mass | 507.01 |
| IUPAC Name | [2-(1,1,2,2-tetrafluoroethoxy)phenyl] N-[(4,6-dimethoxy-1,3,5-triazin-2-yl)sulfamoyl]sulfamate |
| SMILES | COc1nc(NS(=O)(=O)NS(=O)(=O)Oc2ccccc2OC(F)(F)C(F)F)nc(OC)n1 |
| InChI | InChI=1S/C13H13F4N5O8S2/c1-27-11-18-10(19-12(20-11)28-2)21-31(23,24)22-32(25,26)30-8-6-4-3-5-7(8)29-13(16,17)9(14)15/h3-6,9,22H,1-2H3,(H,18,19,20,21) |
| InChIKey | CKCAJIXOKJSXCL-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 167.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.40 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|