C30H52O4 — CID 56620853
2-[(5S)-5-cyclopentyl-1-(oxan-2-yloxy)-7-[(1R,2S)-2-prop-1-enylcyclopentyl]heptoxy]oxane (PubChem CID 56620853) has the molecular formula C30H52O4 and a molecular weight of 476.74 g/mol. Its IUPAC name is 2-[(5S)-5-cyclopentyl-1-(oxan-2-yloxy)-7-[(1R,2S)-2-prop-1-enylcyclopentyl]heptoxy]oxane.
| Compound Name | 2-[(5S)-5-cyclopentyl-1-(oxan-2-yloxy)-7-[(1R,2S)-2-prop-1-enylcyclopentyl]heptoxy]oxane |
|---|---|
| PubChem CID | 56620853 |
| Molecular Formula | C30H52O4 |
| Molecular Weight | 476.74 g/mol |
| Exact Mass | 476.39 |
| IUPAC Name | 2-[(5S)-5-cyclopentyl-1-(oxan-2-yloxy)-7-[(1R,2S)-2-prop-1-enylcyclopentyl]heptoxy]oxane |
| SMILES | CC=C[C@H]1CCC[C@@H]1CC[C@H](CCCC(OC1CCCCO1)OC1CCCCO1)C1CCCC1 |
| InChI | InChI=1S/C30H52O4/c1-2-11-24-14-9-15-26(24)20-21-27(25-12-3-4-13-25)16-10-19-30(33-28-17-5-7-22-31-28)34-29-18-6-8-23-32-29/h2,11,24-30H,3-10,12-23H2,1H3/t24-,26+,27-,28?,29?,30?/m0/s1 |
| InChIKey | NZQPYXBPRCYQFT-RPJQLPHUSA-N |
| XLogP | 8.15 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.74 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|