About 1-(1,2-benzothiazol-3-yl)-1,2-dimethylhydrazine
1-(1,2-benzothiazol-3-yl)-1,2-dimethylhydrazine (PubChem CID 56621026) has the molecular formula C9H11N3S
and a molecular weight of 193.28 g/mol. Its IUPAC name is 1-(1,2-benzothiazol-3-yl)-1,2-dimethylhydrazine.
Molecular Properties
| Compound Name | 1-(1,2-benzothiazol-3-yl)-1,2-dimethylhydrazine |
| PubChem CID | 56621026 |
| Molecular Formula | C9H11N3S |
| Molecular Weight | 193.28 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 1-(1,2-benzothiazol-3-yl)-1,2-dimethylhydrazine |
| SMILES | CNN(C)c1nsc2ccccc12 |
| InChI | InChI=1S/C9H11N3S/c1-10-12(2)9-7-5-3-4-6-8(7)13-11-9/h3-6,10H,1-2H3 |
| InChIKey | IBMXVQPABYJUSV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,2-benzothiazol-3-yl)-1,2-dimethylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,2-benzothiazol-3-yl)-1,2-dimethylhydrazine?
The IUPAC name of 1-(1,2-benzothiazol-3-yl)-1,2-dimethylhydrazine (CID 56621026) is 1-(1,2-benzothiazol-3-yl)-1,2-dimethylhydrazine.
What is the SMILES notation for 1-(1,2-benzothiazol-3-yl)-1,2-dimethylhydrazine?
The canonical SMILES for 1-(1,2-benzothiazol-3-yl)-1,2-dimethylhydrazine is CNN(C)c1nsc2ccccc12.
What is the InChIKey of 1-(1,2-benzothiazol-3-yl)-1,2-dimethylhydrazine?
The InChIKey is IBMXVQPABYJUSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3S/c1-10-12(2)9-7-5-3-4-6-8(7)13-11-9/h3-6,10H,1-2H3.
What are the key properties of 1-(1,2-benzothiazol-3-yl)-1,2-dimethylhydrazine?
1-(1,2-benzothiazol-3-yl)-1,2-dimethylhydrazine has a molecular weight of 193.28 g/mol, XLogP of 1.87, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,2-benzothiazol-3-yl)-1,2-dimethylhydrazine is sourced from PubChem (CID 56621026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).