C10H19N — CID 56621342
1,7-dimethyl-2,3,3a,4,5,6,7,7a-octahydroindole (PubChem CID 56621342) has the molecular formula C10H19N and a molecular weight of 153.27 g/mol. Its IUPAC name is 1,7-dimethyl-2,3,3a,4,5,6,7,7a-octahydroindole.
| Compound Name | 1,7-dimethyl-2,3,3a,4,5,6,7,7a-octahydroindole |
|---|---|
| PubChem CID | 56621342 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | 1,7-dimethyl-2,3,3a,4,5,6,7,7a-octahydroindole |
| SMILES | CC1CCCC2CCN(C)C12 |
| InChI | InChI=1S/C10H19N/c1-8-4-3-5-9-6-7-11(2)10(8)9/h8-10H,3-7H2,1-2H3 |
| InChIKey | LSUGWRMIBDMUNA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |