About 2-(2,5-dimethoxy-4-nitrophenyl)sulfonylethanol
2-(2,5-dimethoxy-4-nitrophenyl)sulfonylethanol (PubChem CID 56621447) has the molecular formula C10H13NO7S
and a molecular weight of 291.28 g/mol. Its IUPAC name is 2-(2,5-dimethoxy-4-nitrophenyl)sulfonylethanol.
Molecular Properties
| Compound Name | 2-(2,5-dimethoxy-4-nitrophenyl)sulfonylethanol |
| PubChem CID | 56621447 |
| Molecular Formula | C10H13NO7S |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 2-(2,5-dimethoxy-4-nitrophenyl)sulfonylethanol |
| SMILES | COc1cc(S(=O)(=O)CCO)c(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H13NO7S/c1-17-8-6-10(19(15,16)4-3-12)9(18-2)5-7(8)11(13)14/h5-6,12H,3-4H2,1-2H3 |
| InChIKey | BOVWYQMLLAPNSN-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dimethoxy-4-nitrophenyl)sulfonylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dimethoxy-4-nitrophenyl)sulfonylethanol?
The IUPAC name of 2-(2,5-dimethoxy-4-nitrophenyl)sulfonylethanol (CID 56621447) is 2-(2,5-dimethoxy-4-nitrophenyl)sulfonylethanol.
What is the SMILES notation for 2-(2,5-dimethoxy-4-nitrophenyl)sulfonylethanol?
The canonical SMILES for 2-(2,5-dimethoxy-4-nitrophenyl)sulfonylethanol is COc1cc(S(=O)(=O)CCO)c(OC)cc1[N+](=O)[O-].
What is the InChIKey of 2-(2,5-dimethoxy-4-nitrophenyl)sulfonylethanol?
The InChIKey is BOVWYQMLLAPNSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO7S/c1-17-8-6-10(19(15,16)4-3-12)9(18-2)5-7(8)11(13)14/h5-6,12H,3-4H2,1-2H3.
What are the key properties of 2-(2,5-dimethoxy-4-nitrophenyl)sulfonylethanol?
2-(2,5-dimethoxy-4-nitrophenyl)sulfonylethanol has a molecular weight of 291.28 g/mol, XLogP of 0.38, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethoxy-4-nitrophenyl)sulfonylethanol is sourced from PubChem (CID 56621447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).