About butyl N-ethylidenecarbamate
butyl N-ethylidenecarbamate (PubChem CID 56621636) has the molecular formula C7H13NO2
and a molecular weight of 143.19 g/mol. Its IUPAC name is butyl N-ethylidenecarbamate.
Molecular Properties
| Compound Name | butyl N-ethylidenecarbamate |
| PubChem CID | 56621636 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | butyl N-ethylidenecarbamate |
| SMILES | CC=NC(=O)OCCCC |
| InChI | InChI=1S/C7H13NO2/c1-3-5-6-10-7(9)8-4-2/h4H,3,5-6H2,1-2H3 |
| InChIKey | ILFLCGZXHJUTFT-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze butyl N-ethylidenecarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl N-ethylidenecarbamate?
The IUPAC name of butyl N-ethylidenecarbamate (CID 56621636) is butyl N-ethylidenecarbamate.
What is the SMILES notation for butyl N-ethylidenecarbamate?
The canonical SMILES for butyl N-ethylidenecarbamate is CC=NC(=O)OCCCC.
What is the InChIKey of butyl N-ethylidenecarbamate?
The InChIKey is ILFLCGZXHJUTFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2/c1-3-5-6-10-7(9)8-4-2/h4H,3,5-6H2,1-2H3.
What are the key properties of butyl N-ethylidenecarbamate?
butyl N-ethylidenecarbamate has a molecular weight of 143.19 g/mol, XLogP of 2.01, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butyl N-ethylidenecarbamate is sourced from PubChem (CID 56621636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).