About 2H-pyran-5-carboxamide
2H-pyran-5-carboxamide (PubChem CID 56621790) has the molecular formula C6H7NO2
and a molecular weight of 125.13 g/mol. Its IUPAC name is 2H-pyran-5-carboxamide.
Molecular Properties
| Compound Name | 2H-pyran-5-carboxamide |
| PubChem CID | 56621790 |
| Molecular Formula | C6H7NO2 |
| Molecular Weight | 125.13 g/mol |
| Exact Mass | 125.05 |
| IUPAC Name | 2H-pyran-5-carboxamide |
| SMILES | NC(=O)C1=COCC=C1 |
| InChI | InChI=1S/C6H7NO2/c7-6(8)5-2-1-3-9-4-5/h1-2,4H,3H2,(H2,7,8) |
| InChIKey | ZKKMHTVYCRUHLW-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.13 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2H-pyran-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-pyran-5-carboxamide?
The IUPAC name of 2H-pyran-5-carboxamide (CID 56621790) is 2H-pyran-5-carboxamide.
What is the SMILES notation for 2H-pyran-5-carboxamide?
The canonical SMILES for 2H-pyran-5-carboxamide is NC(=O)C1=COCC=C1.
What is the InChIKey of 2H-pyran-5-carboxamide?
The InChIKey is ZKKMHTVYCRUHLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2/c7-6(8)5-2-1-3-9-4-5/h1-2,4H,3H2,(H2,7,8).
What are the key properties of 2H-pyran-5-carboxamide?
2H-pyran-5-carboxamide has a molecular weight of 125.13 g/mol, XLogP of -0.06, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-pyran-5-carboxamide is sourced from PubChem (CID 56621790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).