C34H60O4 — CID 56621895
2-[(5S)-5-[(1R,3R)-3-butylcyclopentyl]-1-(oxan-2-yloxy)-7-[(1R,2S)-2-prop-1-enylcyclopentyl]heptoxy]oxane (PubChem CID 56621895) has the molecular formula C34H60O4 and a molecular weight of 532.85 g/mol. Its IUPAC name is 2-[(5S)-5-[(1R,3R)-3-butylcyclopentyl]-1-(oxan-2-yloxy)-7-[(1R,2S)-2-prop-1-enylcyclopentyl]heptoxy]oxane.
| Compound Name | 2-[(5S)-5-[(1R,3R)-3-butylcyclopentyl]-1-(oxan-2-yloxy)-7-[(1R,2S)-2-prop-1-enylcyclopentyl]heptoxy]oxane |
|---|---|
| PubChem CID | 56621895 |
| Molecular Formula | C34H60O4 |
| Molecular Weight | 532.85 g/mol |
| Exact Mass | 532.45 |
| IUPAC Name | 2-[(5S)-5-[(1R,3R)-3-butylcyclopentyl]-1-(oxan-2-yloxy)-7-[(1R,2S)-2-prop-1-enylcyclopentyl]heptoxy]oxane |
| SMILES | CC=C[C@H]1CCC[C@@H]1CC[C@H](CCCC(OC1CCCCO1)OC1CCCCO1)[C@@H]1CC[C@@H](CCCC)C1 |
| InChI | InChI=1S/C34H60O4/c1-3-5-13-27-20-21-31(26-27)30(23-22-29-15-10-14-28(29)12-4-2)16-11-19-34(37-32-17-6-8-24-35-32)38-33-18-7-9-25-36-33/h4,12,27-34H,3,5-11,13-26H2,1-2H3/t27-,28+,29-,30+,31-,32?,33?,34?/m1/s1 |
| InChIKey | WYQBHPHVMANALI-RLKKVLDXSA-N |
| XLogP | 9.56 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.85 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|