C9H20O4Si — CID 56622252
3,3,6,6,7-pentamethyl-1,2,4,5,3-tetraoxasilonane (PubChem CID 56622252) has the molecular formula C9H20O4Si and a molecular weight of 220.34 g/mol. Its IUPAC name is 3,3,6,6,7-pentamethyl-1,2,4,5,3-tetraoxasilonane.
| Compound Name | 3,3,6,6,7-pentamethyl-1,2,4,5,3-tetraoxasilonane |
|---|---|
| PubChem CID | 56622252 |
| Molecular Formula | C9H20O4Si |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 3,3,6,6,7-pentamethyl-1,2,4,5,3-tetraoxasilonane |
| SMILES | CC1CCOO[Si](C)(C)OOC1(C)C |
| InChI | InChI=1S/C9H20O4Si/c1-8-6-7-10-12-14(4,5)13-11-9(8,2)3/h8H,6-7H2,1-5H3 |
| InChIKey | KENPPDGIBKTQNW-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|