About 2-(4-chlorophenyl)-3,9a-dihydro-2H-imidazo[1,2-a]quinoxalin-1-one
2-(4-chlorophenyl)-3,9a-dihydro-2H-imidazo[1,2-a]quinoxalin-1-one (PubChem CID 56622267) has the molecular formula C16H12ClN3O
and a molecular weight of 297.75 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3,9a-dihydro-2H-imidazo[1,2-a]quinoxalin-1-one.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-3,9a-dihydro-2H-imidazo[1,2-a]quinoxalin-1-one |
| PubChem CID | 56622267 |
| Molecular Formula | C16H12ClN3O |
| Molecular Weight | 297.75 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 2-(4-chlorophenyl)-3,9a-dihydro-2H-imidazo[1,2-a]quinoxalin-1-one |
| SMILES | O=C1C(c2ccc(Cl)cc2)NC2=CN=C3C=CC=CC3N12 |
| InChI | InChI=1S/C16H12ClN3O/c17-11-7-5-10(6-8-11)15-16(21)20-13-4-2-1-3-12(13)18-9-14(20)19-15/h1-9,13,15,19H |
| InChIKey | DIBFXQPLRWYPHE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.75 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-chlorophenyl)-3,9a-dihydro-2H-imidazo[1,2-a]quinoxalin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-3,9a-dihydro-2H-imidazo[1,2-a]quinoxalin-1-one?
The IUPAC name of 2-(4-chlorophenyl)-3,9a-dihydro-2H-imidazo[1,2-a]quinoxalin-1-one (CID 56622267) is 2-(4-chlorophenyl)-3,9a-dihydro-2H-imidazo[1,2-a]quinoxalin-1-one.
What is the SMILES notation for 2-(4-chlorophenyl)-3,9a-dihydro-2H-imidazo[1,2-a]quinoxalin-1-one?
The canonical SMILES for 2-(4-chlorophenyl)-3,9a-dihydro-2H-imidazo[1,2-a]quinoxalin-1-one is O=C1C(c2ccc(Cl)cc2)NC2=CN=C3C=CC=CC3N12.
What is the InChIKey of 2-(4-chlorophenyl)-3,9a-dihydro-2H-imidazo[1,2-a]quinoxalin-1-one?
The InChIKey is DIBFXQPLRWYPHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12ClN3O/c17-11-7-5-10(6-8-11)15-16(21)20-13-4-2-1-3-12(13)18-9-14(20)19-15/h1-9,13,15,19H.
What are the key properties of 2-(4-chlorophenyl)-3,9a-dihydro-2H-imidazo[1,2-a]quinoxalin-1-one?
2-(4-chlorophenyl)-3,9a-dihydro-2H-imidazo[1,2-a]quinoxalin-1-one has a molecular weight of 297.75 g/mol, XLogP of 2.56, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-3,9a-dihydro-2H-imidazo[1,2-a]quinoxalin-1-one is sourced from PubChem (CID 56622267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).