C29H40O6 — CID 56622496
16-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-2,6,10,14-tetramethylhexadeca-2,6,10,14-tetraenoic acid (PubChem CID 56622496) has the molecular formula C29H40O6 and a molecular weight of 484.63 g/mol. Its IUPAC name is 16-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-2,6,10,14-tetramethylhexadeca-2,6,10,14-tetraenoic acid.
| Compound Name | 16-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-2,6,10,14-tetramethylhexadeca-2,6,10,14-tetraenoic acid |
|---|---|
| PubChem CID | 56622496 |
| Molecular Formula | C29H40O6 |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | 16-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-2,6,10,14-tetramethylhexadeca-2,6,10,14-tetraenoic acid |
| SMILES | COC1=C(OC)C(=O)C(CC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C(=O)O)=C(C)C1=O |
| InChI | InChI=1S/C29H40O6/c1-19(11-8-12-20(2)15-10-16-22(4)29(32)33)13-9-14-21(3)17-18-24-23(5)25(30)27(34-6)28(35-7)26(24)31/h12-13,16-17H,8-11,14-15,18H2,1-7H3,(H,32,33) |
| InChIKey | KAAGASOFSKQNCN-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|