About 5-butyl-2-chloro-1,3-thiazole
5-butyl-2-chloro-1,3-thiazole (PubChem CID 56622732) has the molecular formula C7H10ClNS
and a molecular weight of 175.68 g/mol. Its IUPAC name is 5-butyl-2-chloro-1,3-thiazole.
Molecular Properties
| Compound Name | 5-butyl-2-chloro-1,3-thiazole |
| PubChem CID | 56622732 |
| Molecular Formula | C7H10ClNS |
| Molecular Weight | 175.68 g/mol |
| Exact Mass | 175.02 |
| IUPAC Name | 5-butyl-2-chloro-1,3-thiazole |
| SMILES | CCCCc1cnc(Cl)s1 |
| InChI | InChI=1S/C7H10ClNS/c1-2-3-4-6-5-9-7(8)10-6/h5H,2-4H2,1H3 |
| InChIKey | ZRADESJYPJKSRZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.68 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-butyl-2-chloro-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butyl-2-chloro-1,3-thiazole?
The IUPAC name of 5-butyl-2-chloro-1,3-thiazole (CID 56622732) is 5-butyl-2-chloro-1,3-thiazole.
What is the SMILES notation for 5-butyl-2-chloro-1,3-thiazole?
The canonical SMILES for 5-butyl-2-chloro-1,3-thiazole is CCCCc1cnc(Cl)s1.
What is the InChIKey of 5-butyl-2-chloro-1,3-thiazole?
The InChIKey is ZRADESJYPJKSRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10ClNS/c1-2-3-4-6-5-9-7(8)10-6/h5H,2-4H2,1H3.
What are the key properties of 5-butyl-2-chloro-1,3-thiazole?
5-butyl-2-chloro-1,3-thiazole has a molecular weight of 175.68 g/mol, XLogP of 3.14, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butyl-2-chloro-1,3-thiazole is sourced from PubChem (CID 56622732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).