C18H23F7O3 — CID 56623037
5-butyl-2-[4-(1,1,2,2,3,3,4-heptafluorobutoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane (PubChem CID 56623037) has the molecular formula C18H23F7O3 and a molecular weight of 420.37 g/mol. Its IUPAC name is 5-butyl-2-[4-(1,1,2,2,3,3,4-heptafluorobutoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane.
| Compound Name | 5-butyl-2-[4-(1,1,2,2,3,3,4-heptafluorobutoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 56623037 |
| Molecular Formula | C18H23F7O3 |
| Molecular Weight | 420.37 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 5-butyl-2-[4-(1,1,2,2,3,3,4-heptafluorobutoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane |
| SMILES | CCCCC1COC(C2=CCC(OC(F)(F)C(F)(F)C(F)(F)CF)C=C2)OC1 |
| InChI | InChI=1S/C18H23F7O3/c1-2-3-4-12-9-26-15(27-10-12)13-5-7-14(8-6-13)28-18(24,25)17(22,23)16(20,21)11-19/h5-7,12,14-15H,2-4,8-11H2,1H3 |
| InChIKey | PNEJSNGMLJEIBS-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.37 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|