C22H23FO3 — CID 56623437
(3aS,9bS)-8-[1-(3-fluorophenyl)propoxy]-6-hydroxy-1,2,3,3a,4,9b-hexahydrocyclopenta[a]naphthalen-5-one (PubChem CID 56623437) has the molecular formula C22H23FO3 and a molecular weight of 354.42 g/mol. Its IUPAC name is (3aS,9bS)-8-[1-(3-fluorophenyl)propoxy]-6-hydroxy-1,2,3,3a,4,9b-hexahydrocyclopenta[a]naphthalen-5-one.
| Compound Name | (3aS,9bS)-8-[1-(3-fluorophenyl)propoxy]-6-hydroxy-1,2,3,3a,4,9b-hexahydrocyclopenta[a]naphthalen-5-one |
|---|---|
| PubChem CID | 56623437 |
| Molecular Formula | C22H23FO3 |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | (3aS,9bS)-8-[1-(3-fluorophenyl)propoxy]-6-hydroxy-1,2,3,3a,4,9b-hexahydrocyclopenta[a]naphthalen-5-one |
| SMILES | CCC(Oc1cc(O)c2c(c1)[C@H]1CCC[C@H]1CC2=O)c1cccc(F)c1 |
| InChI | InChI=1S/C22H23FO3/c1-2-21(14-6-3-7-15(23)9-14)26-16-11-18-17-8-4-5-13(17)10-19(24)22(18)20(25)12-16/h3,6-7,9,11-13,17,21,25H,2,4-5,8,10H2,1H3/t13-,17-,21?/m0/s1 |
| InChIKey | BTBOVLIXFYMAIV-PMJXDKCKSA-N |
| XLogP | 5.53 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |