About 2-(diethylamino)ethyl 3-[4-oxo-6,8-di(propan-2-yl)quinazolin-3-yl]prop-2-enoate
2-(diethylamino)ethyl 3-[4-oxo-6,8-di(propan-2-yl)quinazolin-3-yl]prop-2-enoate (PubChem CID 56623508) has the molecular formula C23H33N3O3
and a molecular weight of 399.54 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 3-[4-oxo-6,8-di(propan-2-yl)quinazolin-3-yl]prop-2-enoate.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl 3-[4-oxo-6,8-di(propan-2-yl)quinazolin-3-yl]prop-2-enoate |
| PubChem CID | 56623508 |
| Molecular Formula | C23H33N3O3 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | 2-(diethylamino)ethyl 3-[4-oxo-6,8-di(propan-2-yl)quinazolin-3-yl]prop-2-enoate |
| SMILES | CCN(CC)CCOC(=O)C=Cn1cnc2c(C(C)C)cc(C(C)C)cc2c1=O |
| InChI | InChI=1S/C23H33N3O3/c1-7-25(8-2)11-12-29-21(27)9-10-26-15-24-22-19(17(5)6)13-18(16(3)4)14-20(22)23(26)28/h9-10,13-17H,7-8,11-12H2,1-6H3 |
| InChIKey | CNDYMTUTHOKQGG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(diethylamino)ethyl 3-[4-oxo-6,8-di(propan-2-yl)quinazolin-3-yl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl 3-[4-oxo-6,8-di(propan-2-yl)quinazolin-3-yl]prop-2-enoate?
The IUPAC name of 2-(diethylamino)ethyl 3-[4-oxo-6,8-di(propan-2-yl)quinazolin-3-yl]prop-2-enoate (CID 56623508) is 2-(diethylamino)ethyl 3-[4-oxo-6,8-di(propan-2-yl)quinazolin-3-yl]prop-2-enoate.
What is the SMILES notation for 2-(diethylamino)ethyl 3-[4-oxo-6,8-di(propan-2-yl)quinazolin-3-yl]prop-2-enoate?
The canonical SMILES for 2-(diethylamino)ethyl 3-[4-oxo-6,8-di(propan-2-yl)quinazolin-3-yl]prop-2-enoate is CCN(CC)CCOC(=O)C=Cn1cnc2c(C(C)C)cc(C(C)C)cc2c1=O.
What is the InChIKey of 2-(diethylamino)ethyl 3-[4-oxo-6,8-di(propan-2-yl)quinazolin-3-yl]prop-2-enoate?
The InChIKey is CNDYMTUTHOKQGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H33N3O3/c1-7-25(8-2)11-12-29-21(27)9-10-26-15-24-22-19(17(5)6)13-18(16(3)4)14-20(22)23(26)28/h9-10,13-17H,7-8,11-12H2,1-6H3.
What are the key properties of 2-(diethylamino)ethyl 3-[4-oxo-6,8-di(propan-2-yl)quinazolin-3-yl]prop-2-enoate?
2-(diethylamino)ethyl 3-[4-oxo-6,8-di(propan-2-yl)quinazolin-3-yl]prop-2-enoate has a molecular weight of 399.54 g/mol, XLogP of 4.00, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl 3-[4-oxo-6,8-di(propan-2-yl)quinazolin-3-yl]prop-2-enoate is sourced from PubChem (CID 56623508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).