C22H31F7O3 — CID 56623609
2-[4-(1,1,2,2,3,3,4-heptafluorobutoxy)cyclohexa-1,5-dien-1-yl]-5-octyl-1,3-dioxane (PubChem CID 56623609) has the molecular formula C22H31F7O3 and a molecular weight of 476.47 g/mol. Its IUPAC name is 2-[4-(1,1,2,2,3,3,4-heptafluorobutoxy)cyclohexa-1,5-dien-1-yl]-5-octyl-1,3-dioxane.
| Compound Name | 2-[4-(1,1,2,2,3,3,4-heptafluorobutoxy)cyclohexa-1,5-dien-1-yl]-5-octyl-1,3-dioxane |
|---|---|
| PubChem CID | 56623609 |
| Molecular Formula | C22H31F7O3 |
| Molecular Weight | 476.47 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | 2-[4-(1,1,2,2,3,3,4-heptafluorobutoxy)cyclohexa-1,5-dien-1-yl]-5-octyl-1,3-dioxane |
| SMILES | CCCCCCCCC1COC(C2=CCC(OC(F)(F)C(F)(F)C(F)(F)CF)C=C2)OC1 |
| InChI | InChI=1S/C22H31F7O3/c1-2-3-4-5-6-7-8-16-13-30-19(31-14-16)17-9-11-18(12-10-17)32-22(28,29)21(26,27)20(24,25)15-23/h9-11,16,18-19H,2-8,12-15H2,1H3 |
| InChIKey | PTTZOYHBOWIELJ-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.47 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|