C17H16N2O7S — CID 56623713
[(1R)-1-acetyloxyethyl] (5R)-3-(4-carbamoylphenoxy)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 56623713) has the molecular formula C17H16N2O7S and a molecular weight of 392.39 g/mol. Its IUPAC name is [(1R)-1-acetyloxyethyl] (5R)-3-(4-carbamoylphenoxy)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | [(1R)-1-acetyloxyethyl] (5R)-3-(4-carbamoylphenoxy)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 56623713 |
| Molecular Formula | C17H16N2O7S |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | [(1R)-1-acetyloxyethyl] (5R)-3-(4-carbamoylphenoxy)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | CC(=O)O[C@@H](C)OC(=O)C1=C(Oc2ccc(C(N)=O)cc2)S[C@@H]2CC(=O)N12 |
| InChI | InChI=1S/C17H16N2O7S/c1-8(20)24-9(2)25-16(23)14-17(27-13-7-12(21)19(13)14)26-11-5-3-10(4-6-11)15(18)22/h3-6,9,13H,7H2,1-2H3,(H2,18,22)/t9-,13-/m1/s1 |
| InChIKey | FMPVZFAEFJSMNI-NOZJJQNGSA-N |
| XLogP | 1.09 |
| TPSA | 125.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|