(2R)-2,3-dimethylpyrrolidine-1-carboxylic acid

C7H13NO2 — CID 56623874

IUPAC(2R)-2,3-dimethylpyrrolidine-1-carboxylic acid
SMILESCC1CCN(C(=O)O)[C@@H]1C
InChIInChI=1S/C7H13NO2/c1-5-3-4-8(6(5)2)7(9)10/h5-6H,3-4H2,1-2H3,(H,9,10)/t5?,6-/m1/s1
InChIKeyJAMFYJRYRABDPG-PRJDIBJQSA-N
MW143.19 g/mol
LogP1.39
Rot. Bonds

About (2R)-2,3-dimethylpyrrolidine-1-carboxylic acid

(2R)-2,3-dimethylpyrrolidine-1-carboxylic acid (PubChem CID 56623874) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is (2R)-2,3-dimethylpyrrolidine-1-carboxylic acid.

Molecular Properties

Compound Name(2R)-2,3-dimethylpyrrolidine-1-carboxylic acid
PubChem CID56623874
Molecular FormulaC7H13NO2
Molecular Weight143.19 g/mol
Exact Mass143.09
IUPAC Name(2R)-2,3-dimethylpyrrolidine-1-carboxylic acid
SMILESCC1CCN(C(=O)O)[C@@H]1C
InChIInChI=1S/C7H13NO2/c1-5-3-4-8(6(5)2)7(9)10/h5-6H,3-4H2,1-2H3,(H,9,10)/t5?,6-/m1/s1
InChIKeyJAMFYJRYRABDPG-PRJDIBJQSA-N
XLogP1.39
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500143.19
LogP ≤ 51.39
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze (2R)-2,3-dimethylpyrrolidine-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2,3-dimethylpyrrolidine-1-carboxylic acid?
The IUPAC name of (2R)-2,3-dimethylpyrrolidine-1-carboxylic acid (CID 56623874) is (2R)-2,3-dimethylpyrrolidine-1-carboxylic acid.
What is the SMILES notation for (2R)-2,3-dimethylpyrrolidine-1-carboxylic acid?
The canonical SMILES for (2R)-2,3-dimethylpyrrolidine-1-carboxylic acid is CC1CCN(C(=O)O)[C@@H]1C.
What is the InChIKey of (2R)-2,3-dimethylpyrrolidine-1-carboxylic acid?
The InChIKey is JAMFYJRYRABDPG-PRJDIBJQSA-N. The full InChI is InChI=1S/C7H13NO2/c1-5-3-4-8(6(5)2)7(9)10/h5-6H,3-4H2,1-2H3,(H,9,10)/t5?,6-/m1/s1.
What are the key properties of (2R)-2,3-dimethylpyrrolidine-1-carboxylic acid?
(2R)-2,3-dimethylpyrrolidine-1-carboxylic acid has a molecular weight of 143.19 g/mol, XLogP of 1.39, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2,3-dimethylpyrrolidine-1-carboxylic acid is sourced from PubChem (CID 56623874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).