C14H14O2 — CID 56623957
3,4,4a,5,10,10a-hexahydroanthracene-1,2-dione (PubChem CID 56623957) has the molecular formula C14H14O2 and a molecular weight of 214.26 g/mol. Its IUPAC name is 3,4,4a,5,10,10a-hexahydroanthracene-1,2-dione.
| Compound Name | 3,4,4a,5,10,10a-hexahydroanthracene-1,2-dione |
|---|---|
| PubChem CID | 56623957 |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 3,4,4a,5,10,10a-hexahydroanthracene-1,2-dione |
| SMILES | O=C1CCC2CC3CC=CC=C3C=C2C1=O |
| InChI | InChI=1S/C14H14O2/c15-13-6-5-11-7-9-3-1-2-4-10(9)8-12(11)14(13)16/h1-2,4,8-9,11H,3,5-7H2 |
| InChIKey | LVNMGGHCIGYFHP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|