C35H38O4SSi — CID 56623966
(3R,4S,5R)-3-(benzenesulfinyl)-5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-4-phenyloxolan-2-one (PubChem CID 56623966) has the molecular formula C35H38O4SSi and a molecular weight of 582.84 g/mol. Its IUPAC name is (3R,4S,5R)-3-(benzenesulfinyl)-5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-4-phenyloxolan-2-one.
| Compound Name | (3R,4S,5R)-3-(benzenesulfinyl)-5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-4-phenyloxolan-2-one |
|---|---|
| PubChem CID | 56623966 |
| Molecular Formula | C35H38O4SSi |
| Molecular Weight | 582.84 g/mol |
| Exact Mass | 582.23 |
| IUPAC Name | (3R,4S,5R)-3-(benzenesulfinyl)-5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-4-phenyloxolan-2-one |
| SMILES | CC(C)(C)[Si](OCCC[C@H]1OC(=O)[C@H](S(=O)c2ccccc2)[C@H]1c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H38O4SSi/c1-35(2,3)41(29-21-12-6-13-22-29,30-23-14-7-15-24-30)38-26-16-25-31-32(27-17-8-4-9-18-27)33(34(36)39-31)40(37)28-19-10-5-11-20-28/h4-15,17-24,31-33H,16,25-26H2,1-3H3/t31-,32+,33-,40?/m1/s1 |
| InChIKey | IJUNWCKXOOWPNF-QMUFMDSASA-N |
| XLogP | 6.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.84 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|