C7H12N2 — CID 56624006
1,5-dimethyl-2H-pyridin-2-amine (PubChem CID 56624006) has the molecular formula C7H12N2 and a molecular weight of 124.19 g/mol. Its IUPAC name is 1,5-dimethyl-2H-pyridin-2-amine.
| Compound Name | 1,5-dimethyl-2H-pyridin-2-amine |
|---|---|
| PubChem CID | 56624006 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 1,5-dimethyl-2H-pyridin-2-amine |
| SMILES | CC1=CN(C)C(N)C=C1 |
| InChI | InChI=1S/C7H12N2/c1-6-3-4-7(8)9(2)5-6/h3-5,7H,8H2,1-2H3 |
| InChIKey | WEFSGFFPTMGDOY-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |